ChemNet > CAS > 1667-00-1 Cyclopropylphenylmethane
1667-00-1 Cyclopropylphenylmethane
| Nama produk |
Cyclopropylphenylmethane |
| Sinonim |
; benzylcyclopropane; (cyclopropylmethyl)benzena |
| Nama Inggeris |
Cyclopropylphenylmethane; benzylcyclopropane; (cyclopropylmethyl)benzene |
| MF |
C10H12 |
| Berat Molekul |
132.2023 |
| InChI |
InChI=1/C10H12/c1-2-4-9(5-3-1)8-10-6-7-10/h1-5,10H,6-8H2 |
| CAS NO |
1667-00-1 |
| EINECS |
216-782-3 |
| Struktur Molekul |
|
| Kepadatan |
1.005g/cm3 |
| Titik didih |
189.7°C at 760 mmHg |
| Indeks bias |
1.567 |
| Titik nyala |
59.1°C |
| Tekanan wap |
0.777mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
