ChemNet > CAS > 16718-11-9 3-(Phenylthio)thiophene
16718-11-9 3-(Phenylthio)thiophene
| Nama produk |
3-(Phenylthio)thiophene |
| Nama Inggeris |
3-(Phenylthio)thiophene; Phenyl 3-thienyl sulphide; 3-(phenylsulfanyl)thiophene |
| MF |
C10H8S2 |
| Berat Molekul |
192.3005 |
| InChI |
InChI=1/C10H8S2/c1-2-4-9(5-3-1)12-10-6-7-11-8-10/h1-8H |
| CAS NO |
16718-11-9 |
| Struktur Molekul |
|
| Kepadatan |
1.24g/cm3 |
| Titik didih |
304.7°C at 760 mmHg |
| Indeks bias |
1.667 |
| Titik nyala |
138.1°C |
| Tekanan wap |
0.00155mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
