ChemNet > CAS > 17213-57-9 3,5-Dimethoxybenzoyl chloride
17213-57-9 3,5-Dimethoxybenzoyl chloride
Nama produk |
3,5-Dimethoxybenzoyl chloride |
Nama Inggeris |
3,5-Dimethoxybenzoyl chloride; |
MF |
C9H9ClO3 |
Berat Molekul |
200.619 |
InChI |
InChI=1/C9H9ClO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3 |
CAS NO |
17213-57-9 |
EINECS |
241-256-5 |
Struktur Molekul |
|
Kepadatan |
1.224g/cm3 |
Titik lebur |
41-47℃ |
Titik didih |
284.5°C at 760 mmHg |
Indeks bias |
1.52 |
Titik nyala |
131.1°C |
Tekanan wap |
0.00296mmHg at 25°C |
Cinta bahaya |
C:Corrosive;
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|