ChemNet > CAS > 17846-15-0 adamantane-1-carbohydrazide
17846-15-0 adamantane-1-carbohydrazide
| Nama produk |
adamantane-1-carbohydrazide |
| Nama Inggeris |
adamantane-1-carbohydrazide; tricyclo[3.3.1.1~3,7~]decane-1-carbohydrazide |
| MF |
C11H18N2O |
| Berat Molekul |
194.2734 |
| InChI |
InChI=1/C11H18N2O/c12-13-10(14)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6,12H2,(H,13,14) |
| CAS NO |
17846-15-0 |
| Struktur Molekul |
|
| Kepadatan |
1.203g/cm3 |
| Titik lebur |
157℃ |
| Titik didih |
370.8°C at 760 mmHg |
| Indeks bias |
1.581 |
| Titik nyala |
178°C |
| Tekanan wap |
1.08E-05mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
