ChemNet > CAS > 18635-45-5 2,3-Diaminopropionic acid hydrobromide
18635-45-5 2,3-Diaminopropionic acid hydrobromide
Nama produk |
2,3-Diaminopropionic acid hydrobromide |
Nama Inggeris |
2,3-Diaminopropionic acid hydrobromide;(2S)-2,3-diammoniopropanoate; (2R)-2,3-diammoniopropanoate |
MF |
C3H9N2O2 |
Berat Molekul |
105.1152 |
InChI |
InChI=1/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)/p+1/t2-/m1/s1 |
CAS NO |
18635-45-5 |
EINECS |
242-467-5 |
Struktur Molekul |
|
Titik lebur |
232℃ |
Titik didih |
325.6°C at 760 mmHg |
Titik nyala |
150.7°C |
Tekanan wap |
4.58E-05mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|