ChemNet > CAS > 18729-48-1 3-Methylcyclopentanol, mixture of isomers
18729-48-1 3-Methylcyclopentanol, mixture of isomers
| Nama produk |
3-Methylcyclopentanol, mixture of isomers |
| Nama Inggeris |
3-Methylcyclopentanol, mixture of isomers; 1-Methyl-3-cyclopentanol; 3-methylcyclopentanol; (1S,3S)-3-methylcyclopentanol |
| MF |
C6H12O |
| Berat Molekul |
100.1589 |
| InChI |
InChI=1/C6H12O/c1-5-2-3-6(7)4-5/h5-7H,2-4H2,1H3/t5-,6-/m0/s1 |
| CAS NO |
18729-48-1 |
| EINECS |
242-540-1 |
| Struktur Molekul |
|
| Kepadatan |
0.947g/cm3 |
| Titik didih |
146.9°C at 760 mmHg |
| Indeks bias |
1.467 |
| Titik nyala |
55°C |
| Tekanan wap |
1.77mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R10:Flammable.;
|
| Keselamatan Penerangan |
S16:Keep away from sources of ignition - No smoking.;
|
|
