ChemNet > CAS > 1884-68-0 2,3,4,5-Tetraphenylthiophene
1884-68-0 2,3,4,5-Tetraphenylthiophene
Nama produk |
2,3,4,5-Tetraphenylthiophene |
Nama Inggeris |
2,3,4,5-Tetraphenylthiophene; Tetraphenylthiophene |
MF |
C28H20S |
Berat Molekul |
388.5234 |
InChI |
InChI=1/C28H20S/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)28(24-19-11-4-12-20-24)29-27(25)23-17-9-3-10-18-23/h1-20H |
CAS NO |
1884-68-0 |
EINECS |
217-545-7 |
Struktur Molekul |
|
Kepadatan |
1.142g/cm3 |
Titik didih |
402.2°C at 760 mmHg |
Indeks bias |
1.643 |
Titik nyala |
147.8°C |
Tekanan wap |
2.58E-06mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|