ChemNet > CAS > 190011-87-1 3-Chloro-2,6-difluorobenzaldehyde
190011-87-1 3-Chloro-2,6-difluorobenzaldehyde
| Nama produk |
3-Chloro-2,6-difluorobenzaldehyde |
| Nama Inggeris |
3-Chloro-2,6-difluorobenzaldehyde; |
| MF |
C7H3ClF2O |
| Berat Molekul |
176.5479 |
| InChI |
InChI=1/C7H3ClF2O/c8-5-1-2-6(9)4(3-11)7(5)10/h1-3H |
| CAS NO |
190011-87-1 |
| Struktur Molekul |
|
| Kepadatan |
1.453g/cm3 |
| Titik lebur |
46-49℃ |
| Titik didih |
207.8°C at 760 mmHg |
| Indeks bias |
1.536 |
| Titik nyala |
79.5°C |
| Tekanan wap |
0.221mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
