ChemNet > CAS > 19241-38-4 4-Bromo-2-methylphenyl isothiocyanate
19241-38-4 4-Bromo-2-methylphenyl isothiocyanate
| Nama produk |
4-Bromo-2-methylphenyl isothiocyanate |
| Nama Inggeris |
4-Bromo-2-methylphenyl isothiocyanate; 4-Bromo-2-methylisothiocyanatobenzene; 4-bromo-1-isothiocyanato-2-methylbenzene; 1-bromo-4-isothiocyanato-2-methylbenzene |
| MF |
C8H6BrNS |
| Berat Molekul |
228.1089 |
| InChI |
InChI=1/C8H6BrNS/c1-6-4-7(10-5-11)2-3-8(6)9/h2-4H,1H3 |
| CAS NO |
19241-38-4 |
| EINECS |
242-907-6 |
| Struktur Molekul |
|
| Kepadatan |
1.44g/cm3 |
| Titik didih |
307.9°C at 760 mmHg |
| Indeks bias |
1.608 |
| Titik nyala |
140°C |
| Tekanan wap |
0.00128mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
