ChemNet > CAS > 19847-10-0 2-Pyrazinecarbonyl chloride
19847-10-0 2-Pyrazinecarbonyl chloride
Nama produk |
2-Pyrazinecarbonyl chloride |
Nama Inggeris |
2-Pyrazinecarbonyl chloride; Pyrazinecarbonyl chloride; Pyrazine-2-carbonyl chloride |
MF |
C5H3ClN2O |
Berat Molekul |
142.5431 |
InChI |
InChI=1/C5H3ClN2O/c6-5(9)4-3-7-1-2-8-4/h1-3H |
CAS NO |
19847-10-0 |
EINECS |
243-367-4 |
Struktur Molekul |
|
Kepadatan |
1.393g/cm3 |
Titik lebur |
40.9℃ |
Titik didih |
214.5°C at 760 mmHg |
Indeks bias |
1.551 |
Titik nyala |
83.5°C |
Tekanan wap |
0.155mmHg at 25°C |
Cinta bahaya |
C:Corrosive;
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|