ChemNet > CAS > 2024-83-1 3,4-Dimethoxybenzonitrile
2024-83-1 3,4-Dimethoxybenzonitrile
| Nama produk |
3,4-Dimethoxybenzonitrile |
| Nama Inggeris |
3,4-Dimethoxybenzonitrile; Veratronitrile; 3,4-Dimethoybenzonitrile |
| MF |
C9H9NO2 |
| Berat Molekul |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
| CAS NO |
2024-83-1 |
| EINECS |
217-969-2 |
| Struktur Molekul |
|
| Kepadatan |
1.12g/cm3 |
| Titik lebur |
66-71℃ |
| Titik didih |
266.2°C at 760 mmHg |
| Indeks bias |
1.519 |
| Titik nyala |
107.5°C |
| Tekanan wap |
0.00877mmHg at 25°C |
| Cinta bahaya |
 Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|
