ChemNet > CAS > 208186-78-1 5-Chloro-1,2-dibromo-3-fluorobenzene
208186-78-1 5-Chloro-1,2-dibromo-3-fluorobenzene
Nama produk |
5-Chloro-1,2-dibromo-3-fluorobenzene |
Nama Inggeris |
5-Chloro-1,2-dibromo-3-fluorobenzene; 5-Chloro-2,3-dibromo-1-fluorobenzene; 1,2-Dibromo-5-chloro-3-fluorobenzene; 1,2-Dibromo-5-chloro-3-fluorobenzene |
MF |
C6H2Br2ClF |
Berat Molekul |
288.3395 |
InChI |
InChI=1/C6H2Br2ClF/c7-4-1-3(9)2-5(10)6(4)8/h1-2H |
CAS NO |
208186-78-1 |
Struktur Molekul |
|
Kepadatan |
2.089g/cm3 |
Titik didih |
245.3°C at 760 mmHg |
Indeks bias |
1.589 |
Titik nyala |
102.1°C |
Tekanan wap |
0.0454mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|