ChemNet > CAS > 216019-28-2 3-Isopropylbenzeneboronic acid
216019-28-2 3-Isopropylbenzeneboronic acid
| Nama produk |
3-Isopropylbenzeneboronic acid |
| Nama Inggeris |
3-Isopropylbenzeneboronic acid; 3-Cumylboronic acid; 3-Isopropylphenylboronic acid; (3-Isopropylphenyl)boronic acid; [3-(1-methylethyl)phenyl]boronic acid; 3-isopropylphenylboronicacid; 3-Isoprophenylboronic Acid |
| MF |
C9H13BO2 |
| Berat Molekul |
164.0093 |
| InChI |
InChI=1/C9H13BO2/c1-7(2)8-4-3-5-9(6-8)10(11)12/h3-7,11-12H,1-2H3 |
| CAS NO |
216019-28-2 |
| Struktur Molekul |
|
| Kepadatan |
1.04g/cm3 |
| Titik didih |
294.2°C at 760 mmHg |
| Indeks bias |
1.513 |
| Titik nyala |
131.7°C |
| Tekanan wap |
0.000747mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
