ChemNet > CAS > 216393-55-4 Methyl 3,5-difluorobenzoate
216393-55-4 Methyl 3,5-difluorobenzoate
Nama produk |
Methyl 3,5-difluorobenzoate |
Nama Inggeris |
Methyl 3,5-difluorobenzoate; 3,5-Difluorobenzoic acid methyl ester |
MF |
C8H6F2O2 |
Berat Molekul |
172.1288 |
InChI |
InChI=1/C8H6F2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 |
CAS NO |
216393-55-4 |
Struktur Molekul |
|
Kepadatan |
1.268g/cm3 |
Titik didih |
202.7°C at 760 mmHg |
Indeks bias |
1.472 |
Titik nyala |
74.6°C |
Tekanan wap |
0.288mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|