ChemNet > CAS > 22047-88-7 2-Benzyloxyphenylacetic acid
22047-88-7 2-Benzyloxyphenylacetic acid
Nama produk |
2-Benzyloxyphenylacetic acid |
Nama Inggeris |
2-Benzyloxyphenylacetic acid;[2-(phenoxymethyl)phenyl]acetic acid |
MF |
C15H14O3 |
Berat Molekul |
242.2699 |
InChI |
InChI=1/C15H14O3/c16-15(17)10-12-6-4-5-7-13(12)11-18-14-8-2-1-3-9-14/h1-9H,10-11H2,(H,16,17) |
CAS NO |
22047-88-7 |
Struktur Molekul |
|
Kepadatan |
1.201g/cm3 |
Titik didih |
408.9°C at 760 mmHg |
Indeks bias |
1.595 |
Titik nyala |
154.1°C |
Tekanan wap |
2.03E-07mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|