2216-94-6 Ethyl phenylpropiolate
Nama produk |
Ethyl phenylpropiolate |
Nama Inggeris |
Ethyl phenylpropiolate; Ethyl phenylacetylenecarboxylate~Phenylpropiolic acid ethyl ester; ethyl 3-phenylprop-2-ynoate |
MF |
C11H10O2 |
Berat Molekul |
174.1959 |
InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h3-7H,2H2,1H3 |
CAS NO |
2216-94-6 |
EINECS |
218-703-8 |
Struktur Molekul |
|
Kepadatan |
1.09g/cm3 |
Titik didih |
265°C at 760 mmHg |
Indeks bias |
1.538 |
Titik nyala |
124.9°C |
Tekanan wap |
0.0094mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|