ChemNet > CAS > 22300-56-7 4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid
22300-56-7 4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid
Nama produk |
4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid |
Nama Inggeris |
4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid; 5-Methyl-2-phenyl-2H-1,2,3-triazole-4-carboxylic acid; 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carboxylate |
MF |
C10H8N3O2 |
Berat Molekul |
202.19 |
InChI |
InChI=1/C10H9N3O2/c1-7-9(10(14)15)12-13(11-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,14,15)/p-1 |
CAS NO |
22300-56-7 |
Struktur Molekul |
|
Titik lebur |
200℃ |
Titik didih |
432.9°C at 760 mmHg |
Titik nyala |
215.6°C |
Tekanan wap |
2.91E-08mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|