ChemNet > CAS > 2243-42-7 2-Phenoxybenzoic acid
2243-42-7 2-Phenoxybenzoic acid
| Nama produk |
2-Phenoxybenzoic acid |
| Nama Inggeris |
2-Phenoxybenzoic acid; 2-Carboxydiphenyl ether; 2-phenoxybenzoate |
| MF |
C13H9O3 |
| Berat Molekul |
213.2093 |
| InChI |
InChI=1/C13H10O3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15)/p-1 |
| CAS NO |
2243-42-7 |
| EINECS |
218-811-5 |
| Struktur Molekul |
|
| Titik lebur |
111-115℃ |
| Titik didih |
343.3°C at 760 mmHg |
| Titik nyala |
132°C |
| Tekanan wap |
2.73E-05mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
