ChemNet > CAS > 233585-04-1 2,6-dihydroxy-3-nitrobenzonitrile
233585-04-1 2,6-dihydroxy-3-nitrobenzonitrile
| Nama produk |
2,6-dihydroxy-3-nitrobenzonitrile |
| Nama Inggeris |
2,6-dihydroxy-3-nitrobenzonitrile; |
| MF |
C7H4N2O4 |
| Berat Molekul |
180.1177 |
| InChI |
InChI=1/C7H4N2O4/c8-3-4-6(10)2-1-5(7(4)11)9(12)13/h1-2,10-11H |
| CAS NO |
233585-04-1 |
| Struktur Molekul |
|
| Kepadatan |
1.69g/cm3 |
| Titik lebur |
238℃ |
| Titik didih |
358.2°C at 760 mmHg |
| Indeks bias |
1.683 |
| Titik nyala |
170.5°C |
| Tekanan wap |
1.25E-05mmHg at 25°C |
| Cinta bahaya |
Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|