ChemNet > CAS > 23384-72-7 3,4-difluoropropiophenone
23384-72-7 3,4-difluoropropiophenone
| Nama produk |
3,4-difluoropropiophenone |
| Nama Inggeris |
3,4-difluoropropiophenone;3',4'-Difluoropropiophenone; 1-(3,4-difluorophenyl)propan-1-one |
| MF |
C9H8F2O |
| Berat Molekul |
170.156 |
| InChI |
InChI=1/C9H8F2O/c1-2-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3 |
| CAS NO |
23384-72-7 |
| EINECS |
245-627-2 |
| Struktur Molekul |
|
| Kepadatan |
1.166g/cm3 |
| Titik didih |
225°C at 760 mmHg |
| Indeks bias |
1.472 |
| Titik nyala |
84.8°C |
| Tekanan wap |
0.0886mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
