ChemNet > CAS > 24050-49-5 3-Bromo-1,8-naphthalic anhydride
24050-49-5 3-Bromo-1,8-naphthalic anhydride
| Nama produk |
3-Bromo-1,8-naphthalic anhydride |
| Nama Inggeris |
3-Bromo-1,8-naphthalic anhydride; 5-bromo-1H,3H-benzo[de]isochromene-1,3-dione |
| MF |
C12H5BrO3 |
| Berat Molekul |
277.0703 |
| InChI |
InChI=1/C12H5BrO3/c13-7-4-6-2-1-3-8-10(6)9(5-7)12(15)16-11(8)14/h1-5H |
| CAS NO |
24050-49-5 |
| Struktur Molekul |
|
| Kepadatan |
1.812g/cm3 |
| Titik didih |
468.9°C at 760 mmHg |
| Indeks bias |
1.733 |
| Titik nyala |
237.4°C |
| Tekanan wap |
5.78E-09mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
