ChemNet > CAS > 2438-10-0 ( )-Terpinen-4-ol
2438-10-0 ( )-Terpinen-4-ol
| Nama produk |
( )-Terpinen-4-ol |
| Sinonim |
;( )-p-Menth-1-en-4-ol; (S)-4-Isopropyl-1-methyl-1-cyclohexen-4-ol; (1S)-4-methyl-1-(1-methylethyl)cyclohex-3-en-1-ol |
| Nama Inggeris |
(+)-Terpinen-4-ol; (+)-p-Menth-1-en-4-ol; (S)-4-Isopropyl-1-methyl-1-cyclohexen-4-ol; (1S)-4-methyl-1-(1-methylethyl)cyclohex-3-en-1-ol |
| MF |
C10H18O |
| Berat Molekul |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3/t10-/m1/s1 |
| CAS NO |
2438-10-0 |
| Struktur Molekul |
|
| Kepadatan |
0.933g/cm3 |
| Titik didih |
209°C at 760 mmHg |
| Indeks bias |
1.484 |
| Titik nyala |
79.4°C |
| Tekanan wap |
0.0478mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
