ChemNet > CAS > 2439-85-2 N-Bromophthalimide
2439-85-2 N-Bromophthalimide
Nama produk |
N-Bromophthalimide |
Nama Inggeris |
N-Bromophthalimide;AI3-18212; NSC 3525; 1H-Isoindole-1,3(2H)-dione, 2-bromo-; 2-bromo-1H-isoindole-1,3(2H)-dione |
MF |
C8H4BrNO2 |
Berat Molekul |
226.0269 |
InChI |
InChI=1/C8H4BrNO2/c9-10-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H |
CAS NO |
2439-85-2 |
EINECS |
219-467-9 |
Struktur Molekul |
|
Kepadatan |
1.932g/cm3 |
Titik lebur |
199-203℃ |
Titik didih |
332.3°C at 760 mmHg |
Indeks bias |
1.704 |
Titik nyala |
154.8°C |
Tekanan wap |
0.000147mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|