ChemNet > CAS > 24985-85-1 Ethyl 5-hydroxyindole-2-carboxylate
24985-85-1 Ethyl 5-hydroxyindole-2-carboxylate
Nama produk |
Ethyl 5-hydroxyindole-2-carboxylate |
Nama Inggeris |
Ethyl 5-hydroxyindole-2-carboxylate; 5-Hydroxyindole-2-carboxylic acid ethyl ester; ethyl 5-hydroxy-1H-indole-2-carboxylate; (1-benzylpiperidin-3-yl)methanol |
MF |
C13H19NO |
Berat Molekul |
205.2961 |
InChI |
InChI=1/C13H19NO/c15-11-13-7-4-8-14(10-13)9-12-5-2-1-3-6-12/h1-3,5-6,13,15H,4,7-11H2 |
CAS NO |
24985-85-1 |
EINECS |
246-554-9 |
Struktur Molekul |
|
Kepadatan |
1.056g/cm3 |
Titik didih |
294.068°C at 760 mmHg |
Indeks bias |
1.551 |
Titik nyala |
123.378°C |
Tekanan wap |
0.001mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|