ChemNet > CAS > 25038-72-6 poli(vinylidene chloride-co-methyl acrylate)
25038-72-6 poli(vinylidene chloride-co-methyl acrylate)
Nama produk |
poli(vinylidene chloride-co-methyl acrylate) |
Sinonim |
2-Asid propenoic, metil ester, polimer dengan 1,1-dichloroethene; 1,1-Dichloroethene, polimer metil 2-propenoate; 1,1-Dichloroethene, polimer dengan metil 2-propenoate; Vinylidene klorida, polimer metil akrilat; metil prop-2-enoate - 1,1-dichloroethene (1:1) |
Nama Inggeris |
poly(vinylidene chloride-co-methyl acrylate);2-Propenoic acid, methyl ester, polymer with 1,1-dichloroethene; 1,1-Dichloroethene, methyl 2-propenoate polymer; 1,1-Dichloroethene, polymer with methyl 2-propenoate; Vinylidene chloride, methyl acrylate polymer; methyl prop-2-enoate - 1,1-dichloroethene (1:1) |
MF |
C6H8Cl2O2 |
Berat Molekul |
183.0325 |
InChI |
InChI=1/C4H6O2.C2H2Cl2/c1-3-4(5)6-2;1-2(3)4/h3H,1H2,2H3;1H2 |
CAS NO |
25038-72-6 |
Struktur Molekul |
|
Titik lebur |
152℃ |
Titik didih |
80.2°C at 760 mmHg |
Titik nyala |
6.7°C |
Tekanan wap |
86.3mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
|
|