ChemNet > CAS > 2527-99-3 Methyl 5-bromo-2-furoate
2527-99-3 Methyl 5-bromo-2-furoate
| Nama produk |
Methyl 5-bromo-2-furoate |
| Nama Inggeris |
Methyl 5-bromo-2-furoate; methyl 5-bromofuran-2-carboxylate |
| MF |
C6H5BrO3 |
| Berat Molekul |
205.0061 |
| InChI |
InChI=1/C6H5BrO3/c1-9-6(8)4-2-3-5(7)10-4/h2-3H,1H3 |
| CAS NO |
2527-99-3 |
| Struktur Molekul |
|
| Kepadatan |
1.623g/cm3 |
| Titik lebur |
62-65℃ |
| Titik didih |
226.3°C at 760 mmHg |
| Indeks bias |
1.513 |
| Titik nyala |
90.7°C |
| Tekanan wap |
0.0824mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
