ChemNet > CAS > 261762-43-0 3-Chloro-2,6-difluorobenzoyl chloride
261762-43-0 3-Chloro-2,6-difluorobenzoyl chloride
| Nama produk |
3-Chloro-2,6-difluorobenzoyl chloride |
| Nama Inggeris |
3-Chloro-2,6-difluorobenzoyl chloride; |
| MF |
C7H2Cl2F2O |
| Berat Molekul |
210.993 |
| InChI |
InChI=1/C7H2Cl2F2O/c8-3-1-2-4(10)5(6(3)11)7(9)12/h1-2H |
| CAS NO |
261762-43-0 |
| Struktur Molekul |
|
| Kepadatan |
1.548g/cm3 |
| Titik didih |
203.9°C at 760 mmHg |
| Indeks bias |
1.519 |
| Titik nyala |
77.1°C |
| Tekanan wap |
0.271mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
