ChemNet > CAS > 27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
Nama produk |
2,5-Dimethyl-1,3,4-thiadiazole |
Nama Inggeris |
2,5-Dimethyl-1,3,4-thiadiazole;1,3,4-Thiadiazole, 2,5-dimethyl-; 2,5-Dimethylthiadiazole; NSC 93787 |
MF |
C4H6N2S |
Berat Molekul |
114.1688 |
InChI |
InChI=1/C4H6N2S/c1-3-5-6-4(2)7-3/h1-2H3 |
CAS NO |
27464-82-0 |
EINECS |
248-473-4 |
Struktur Molekul |
|
Kepadatan |
1.166g/cm3 |
Titik lebur |
62-65℃ |
Titik didih |
202.5°C at 760 mmHg |
Indeks bias |
1.534 |
Titik nyala |
81.2°C |
Tekanan wap |
0.415mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|