ChemNet > CAS > 28236-62-6 2,4-Dichlorophenoxyacetic acid hydrazide
28236-62-6 2,4-Dichlorophenoxyacetic acid hydrazide
| Nama produk |
2,4-Dichlorophenoxyacetic acid hydrazide |
| Nama Inggeris |
2,4-Dichlorophenoxyacetic acid hydrazide; -2,4-DICHLOROPHENOXYACETIC ACID HYDRAZIDE; 2-(2,4-DICHLOROPHENOXY)ACETOHYDRAZIDE; AKOS BBS-00000671; LABOTEST-BB LT00019836; TIMTEC-BB SBB000731 |
| MF |
C8H8Cl2N2O2 |
| Berat Molekul |
235.0673 |
| InChI |
InChI=1/C8H8Cl2N2O2/c9-5-1-2-7(6(10)3-5)14-4-8(13)12-11/h1-3H,4,11H2,(H,12,13) |
| CAS NO |
28236-62-6 |
| Struktur Molekul |
|
| Kepadatan |
1.438g/cm3 |
| Titik didih |
448.8°C at 760 mmHg |
| Indeks bias |
1.581 |
| Titik nyala |
225.2°C |
| Tekanan wap |
3E-08mmHg at 25°C |
| Cinta bahaya |
 Xn:有害物质‖Xi;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
