ChemNet > CAS > 287172-74-1 2-Chloro-3,6-difluorobenzoic acid
287172-74-1 2-Chloro-3,6-difluorobenzoic acid
| Nama produk |
2-Chloro-3,6-difluorobenzoic acid |
| Nama Inggeris |
2-Chloro-3,6-difluorobenzoic acid; |
| MF |
C7H3ClF2O2 |
| Berat Molekul |
192.5473 |
| InChI |
InChI=1/C7H3ClF2O2/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2H,(H,11,12) |
| CAS NO |
287172-74-1 |
| Struktur Molekul |
|
| Kepadatan |
1.573g/cm3 |
| Titik didih |
266.6°C at 760 mmHg |
| Indeks bias |
1.534 |
| Titik nyala |
115°C |
| Tekanan wap |
0.00427mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
