ChemNet > CAS > 2946-61-4 Dimethyl phenylphosphonite
2946-61-4 Dimethyl phenylphosphonite
Nama produk |
Dimethyl phenylphosphonite |
Nama Inggeris |
Dimethyl phenylphosphonite; Dimethoxyphenylphosphine; Phenyldimethoxyphosphine; Phenylphosphonous acid dimethyl ester |
MF |
C8H11O2P |
Berat Molekul |
170.1455 |
InChI |
InChI=1/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
CAS NO |
2946-61-4 |
EINECS |
220-960-6 |
Struktur Molekul |
|
Titik didih |
194.1°C at 760 mmHg |
Titik nyala |
81°C |
Tekanan wap |
0.628mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|