3019-20-3 Isopropylthiobenzene
Nama produk |
Isopropylthiobenzene |
Nama Inggeris |
Isopropylthiobenzene; (Isopropylthio)benzene; Isopropyl phenyl sulphide; (propan-2-ylsulfanyl)benzene |
MF |
C9H12S |
Berat Molekul |
152.2566 |
InChI |
InChI=1/C9H12S/c1-8(2)10-9-6-4-3-5-7-9/h3-8H,1-2H3 |
CAS NO |
3019-20-3 |
EINECS |
221-162-0 |
Struktur Molekul |
|
Kepadatan |
0.98g/cm3 |
Titik didih |
208°C at 760 mmHg |
Indeks bias |
1.544 |
Titik nyala |
83.2°C |
Tekanan wap |
0.315mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|