ChemNet > CAS > 3019-25-8 cyclobutyl methyl ketone
3019-25-8 cyclobutyl methyl ketone
| Nama produk |
cyclobutyl methyl ketone |
| Nama Inggeris |
cyclobutyl methyl ketone; Acetylcyclobutane; 1-cyclobutylethanone
; 1-cyclobutylethanone |
| MF |
C6H10O |
| Berat Molekul |
98.143 |
| InChI |
InChI=1/C6H10O/c1-5(7)6-3-2-4-6/h6H,2-4H2,1H3 |
| CAS NO |
3019-25-8 |
| EINECS |
221-163-6 |
| Struktur Molekul |
|
| Kepadatan |
0.96g/cm3 |
| Titik didih |
137.5°C at 760 mmHg |
| Indeks bias |
1.453 |
| Titik nyala |
32.3°C |
| Tekanan wap |
7.02mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R10:Flammable.;
|
| Keselamatan Penerangan |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
