ChemNet > CAS > 30273-11-1 4-sec-Butylaniline
30273-11-1 4-sec-Butylaniline
| Nama produk |
4-sec-Butylaniline |
| Nama Inggeris |
4-sec-Butylaniline; benzenamine, 4-(1-methylpropyl)-; p-sec-Butylaniline; 4-(butan-2-yl)aniline; N-(1-methylpropyl)-benzenamine |
| MF |
C10H15N |
| Berat Molekul |
149.2328 |
| InChI |
InChI=1/C10H15N/c1-3-8(2)9-4-6-10(11)7-5-9/h4-8H,3,11H2,1-2H3 |
| CAS NO |
30273-11-1 |
| EINECS |
250-108-9 |
| Struktur Molekul |
|
| Kepadatan |
0.942g/cm3 |
| Titik didih |
244.2°C at 760 mmHg |
| Indeks bias |
1.535 |
| Titik nyala |
107.8°C |
| Tekanan wap |
0.0308mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
