ChemNet > CAS > 305-15-7 2,5-Dichlorophenylhydrazine
305-15-7 2,5-Dichlorophenylhydrazine
| Nama produk |
2,5-Dichlorophenylhydrazine |
| Nama Inggeris |
2,5-Dichlorophenylhydrazine ; -2,5-DICHLOROPHENYLHYDRAZINE; 1-(2,5-DICHLOROPHENYL)HYDRAZINE; (2,5-dichlorophenyl)-hydrazin; Hydrazine, (2,5-dichlorophenyl)-; 2,5-DICHLOROPHENYLHYRAZINE |
| MF |
C6H6Cl2N2 |
| Berat Molekul |
177.0312 |
| InChI |
InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
| CAS NO |
305-15-7 |
| EINECS |
206-163-6 |
| Struktur Molekul |
|
| Kepadatan |
1.475g/cm3 |
| Titik lebur |
100-104℃ |
| Titik didih |
266.8°C at 760 mmHg |
| Indeks bias |
1.665 |
| Titik nyala |
115.1°C |
| Tekanan wap |
0.00848mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
