ChemNet > CAS > 305-53-3 Iodoacetic acid, sodium salt
305-53-3 Iodoacetic acid, sodium salt
Nama produk |
Iodoacetic acid, sodium salt |
Nama Inggeris |
Iodoacetic acid, sodium salt; Sodium iodoacetate; Iodoacetic acid sodium salt |
MF |
C2H2INaO2 |
Berat Molekul |
207.9303 |
InChI |
InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
CAS NO |
305-53-3 |
EINECS |
206-165-7 |
Struktur Molekul |
|
Titik lebur |
208-210℃ |
Titik didih |
262.1°C at 760 mmHg |
Titik nyala |
112.3°C |
Tekanan wap |
0.00329mmHg at 25°C |
Cinta bahaya |
T:Toxic;
|
Kod Risiko |
R25:Toxic if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|