ChemNet > CAS > 306934-87-2 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde
306934-87-2 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde
| Nama produk |
6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde |
| Nama Inggeris |
6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde; 6-Fluoro-1,3-benzodioxene-8-carbaldehyde |
| MF |
C9H7FO3 |
| Berat Molekul |
182.1485 |
| InChI |
InChI=1/C9H7FO3/c10-8-1-6(3-11)9-7(2-8)4-12-5-13-9/h1-3H,4-5H2 |
| CAS NO |
306934-87-2 |
| Struktur Molekul |
|
| Kepadatan |
1.357g/cm3 |
| Titik lebur |
116℃ |
| Titik didih |
323.051°C at 760 mmHg |
| Indeks bias |
1.566 |
| Titik nyala |
144.319°C |
| Tekanan wap |
0mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
