ChemNet > CAS > 31431-13-7 Cyclobutyl-4-fluorophenyl ketone
31431-13-7 Cyclobutyl-4-fluorophenyl ketone
Nama produk |
Cyclobutyl-4-fluorophenyl ketone |
Nama Inggeris |
Cyclobutyl-4-fluorophenyl ketone;Cyclobutyl 4-fluorophenyl ketone; cyclobutyl(4-fluorophenyl)methanone |
MF |
C11H11FO |
Berat Molekul |
178.2028 |
InChI |
InChI=1/C11H11FO/c12-10-6-4-9(5-7-10)11(13)8-2-1-3-8/h4-8H,1-3H2 |
CAS NO |
31431-13-7 |
EINECS |
250-628-6 |
Struktur Molekul |
|
Kepadatan |
1.17g/cm3 |
Titik didih |
268°C at 760 mmHg |
Indeks bias |
1.544 |
Titik nyala |
107.2°C |
Tekanan wap |
0.00789mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|