ChemNet > CAS > 31545-26-3 4-Chloro-3-nitrophenyl cyclopropyl ketone
31545-26-3 4-Chloro-3-nitrophenyl cyclopropyl ketone
Nama produk |
4-Chloro-3-nitrophenyl cyclopropyl ketone |
Sinonim |
(4-chloro-3-nitrophenyl) (cyclopropyl)methanone |
Nama Inggeris |
4-Chloro-3-nitrophenyl cyclopropyl ketone;(4-chloro-3-nitrophenyl)(cyclopropyl)methanone |
MF |
C10H8ClNO3 |
Berat Molekul |
225.6284 |
InChI |
InChI=1/C10H8ClNO3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2H2 |
CAS NO |
31545-26-3 |
EINECS |
250-690-4 |
Struktur Molekul |
|
Kepadatan |
1.464g/cm3 |
Titik lebur |
78-80℃ |
Titik didih |
333.4°C at 760 mmHg |
Indeks bias |
1.631 |
Titik nyala |
155.4°C |
Tekanan wap |
0.000137mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|