ChemNet > CAS > 3160-35-8 4-Hydroxybenzal Acetone
3160-35-8 4-Hydroxybenzal Acetone
| Nama produk |
4-Hydroxybenzal Acetone |
| Nama Inggeris |
4-Hydroxybenzal Acetone; 4-Hydroxybenzylidenacetone; 4-Hydroxybenzylideneacetone; 4-(4-hydroxyphenyl)but-3-en-2-one; (3E)-4-(4-hydroxyphenyl)but-3-en-2-one |
| MF |
C10H10O2 |
| Berat Molekul |
162.1852 |
| InChI |
InChI=1/C10H10O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h2-7,12H,1H3/b3-2+ |
| CAS NO |
3160-35-8 |
| EINECS |
221-607-9 |
| Struktur Molekul |
|
| Kepadatan |
1.138g/cm3 |
| Titik didih |
318.1°C at 760 mmHg |
| Indeks bias |
1.599 |
| Titik nyala |
134.8°C |
| Tekanan wap |
0.000198mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
