320-65-0 2-fluorobenzal chloride
Nama produk |
2-fluorobenzal chloride |
Nama Inggeris |
2-fluorobenzal chloride; alpha,alpha-Dichloro-2-fluorotoluene |
MF |
C7H5Cl2F |
Berat Molekul |
179.02
|
InChI |
InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
CAS NO |
320-65-0 |
EINECS |
206-279-7 |
Struktur Molekul |
|
Kepadatan |
1.3 |
Titik didih |
224℃ |
Cinta bahaya |
|
Kod Risiko |
R34:Causes burns.;
R36:Irritating to eyes.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|