ChemNet > CAS > 3209-72-1 ethyl 5-methylisoxazole-3-carboxylate
3209-72-1 ethyl 5-methylisoxazole-3-carboxylate
Nama produk |
ethyl 5-methylisoxazole-3-carboxylate |
Nama Inggeris |
ethyl 5-methylisoxazole-3-carboxylate; 5-methylisoxazole-3-carboxylate ethyl; ethyl 5-methyl-1,2-oxazole-3-carboxylate |
MF |
C7H9NO3 |
Berat Molekul |
155.1513 |
InChI |
InChI=1/C7H9NO3/c1-3-10-7(9)6-4-5(2)11-8-6/h4H,3H2,1-2H3 |
CAS NO |
3209-72-1 |
EINECS |
221-720-3 |
Struktur Molekul |
|
Kepadatan |
1.139g/cm3 |
Titik lebur |
25℃ |
Titik didih |
246.2°C at 760 mmHg |
Indeks bias |
1.468 |
Titik nyala |
102.7°C |
Tekanan wap |
0.0275mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|