Nama produk |
diethyl thiodicarbonate |
Sinonim |
Asid thiodicarbonic ((HO)C(O)SC(S)(OH)), OC,OC'-DIETHYL ESTER; AI3-19742; Format etil xanthogen etyl; MKN 403191; Asid Xantic, etyl-, anhydrosulfide dengan O-ethyl thiocarbonate; Asid Xantic, etyl-, anhydrosulfide dengan O-ethyl thiolcarbonate; Asid karbonik, dithio-, anhydrosulfide dengan O-ethyl thiocarbonate, ester O-ethyl (8CI); Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH)); Asid thiodicarbonic ((HO)C(O)SC(S)(OH)), ester diethyl; Asid thiodicarbonic, ester diethyl; O, O-diethyl dithiodicarbonate |
Nama Inggeris |
diethyl thiodicarbonate;Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), OC,OC'-diethyl ester; AI3-19742; Ethyl xanthogen ethyl formate; NSC 403191; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate; Carbonic acid, dithio-, anhydrosulfide with O-ethyl thiocarbonate, O-ethyl ester (8CI); Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH)); Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), diethyl ester; Thiodicarbonic acid, diethyl ester; O,O-diethyl dithiodicarbonate |
MF |
C6H10O3S2 |
Berat Molekul |
194.2718 |
InChI |
InChI=1/C6H10O3S2/c1-3-8-5(7)11-6(10)9-4-2/h3-4H2,1-2H3 |
CAS NO |
3278-35-1 |
EINECS |
221-911-1 |
Struktur Molekul |
|
Kepadatan |
1.242g/cm3 |
Titik didih |
236°C at 760 mmHg |
Indeks bias |
1.534 |
Titik nyala |
96.5°C |
Tekanan wap |
0.0487mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
|
|