ChemNet > CAS > 32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
| Nama produk |
2-Chloro-6-fluoro-3-methylbenzoic acid |
| Nama Inggeris |
2-Chloro-6-fluoro-3-methylbenzoic acid; 2-Chloro-6-fluoro-m-toluic acid |
| MF |
C8H6ClFO2 |
| Berat Molekul |
188.5834 |
| InChI |
InChI=1/C8H6ClFO2/c1-4-2-3-5(10)6(7(4)9)8(11)12/h2-3H,1H3,(H,11,12) |
| CAS NO |
32890-89-4 |
| Struktur Molekul |
|
| Kepadatan |
1.403g/cm3 |
| Titik didih |
278.1°C at 760 mmHg |
| Indeks bias |
1.551 |
| Titik nyala |
122°C |
| Tekanan wap |
0.00209mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
