ChemNet > CAS > 3319-99-1 2-(2-thienyl)pyridine
3319-99-1 2-(2-thienyl)pyridine
Nama produk |
2-(2-thienyl)pyridine |
Nama Inggeris |
2-(2-thienyl)pyridine; 2-(2-Pyridyl)thiophene; 2-(thiophen-2-yl)pyridine |
MF |
C9H7NS |
Berat Molekul |
161.2236 |
InChI |
InChI=1/C9H7NS/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-7H |
CAS NO |
3319-99-1 |
EINECS |
222-022-1 |
Struktur Molekul |
|
Kepadatan |
1.173g/cm3 |
Titik didih |
268°C at 760 mmHg |
Indeks bias |
1.604 |
Titik nyala |
115°C |
Tekanan wap |
0.013mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|