ChemNet > CAS > 342002-82-8 4-Asid Isopropoxycarbonylphenylboronic
342002-82-8 4-Asid Isopropoxycarbonylphenylboronic
| Nama produk |
4-Asid Isopropoxycarbonylphenylboronic |
| Sinonim |
{4-[(1-methylethoxy)carbonyl]phenyl}boronic acid |
| Nama Inggeris |
4-Isopropoxycarbonylphenylboronic acid;{4-[(1-methylethoxy)carbonyl]phenyl}boronic acid |
| MF |
C10H13BO4 |
| Berat Molekul |
208.0188 |
| InChI |
InChI=1/C10H13BO4/c1-7(2)15-10(12)8-3-5-9(6-4-8)11(13)14/h3-7,13-14H,1-2H3 |
| CAS NO |
342002-82-8 |
| Struktur Molekul |
|
| Kepadatan |
1.17g/cm3 |
| Titik lebur |
111℃ |
| Titik didih |
359°C at 760 mmHg |
| Indeks bias |
1.519 |
| Titik nyala |
170.9°C |
| Tekanan wap |
8.86E-06mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
