ChemNet > CAS > 347-55-7 2-(trifluoromethylthio)aniline
347-55-7 2-(trifluoromethylthio)aniline
| Nama produk |
2-(trifluoromethylthio)aniline |
| Nama Inggeris |
2-(trifluoromethylthio)aniline; 2-Aminophenyl trifluoromethyl sulphide; 4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
| MF |
C11H11FO4 |
| Berat Molekul |
226.201 |
| InChI |
InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
| CAS NO |
347-55-7 |
| EINECS |
206-473-1 |
| Struktur Molekul |
|
| Kepadatan |
1.279g/cm3 |
| Titik didih |
422.6°C at 760 mmHg |
| Indeks bias |
1.52 |
| Titik nyala |
209.4°C |
| Tekanan wap |
6.78E-08mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
