ChemNet > CAS > 349-01-9 2,4-dinitro-5-fluorotoluene
349-01-9 2,4-dinitro-5-fluorotoluene
| Nama produk |
2,4-dinitro-5-fluorotoluene |
| Nama Inggeris |
2,4-dinitro-5-fluorotoluene; 1-Fluoro-5-methyl-2,4-dinitrobenzene |
| MF |
C7H5FN2O4 |
| Berat Molekul |
200.124 |
| InChI |
InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| CAS NO |
349-01-9 |
| Struktur Molekul |
|
| Kepadatan |
1.497g/cm3 |
| Titik lebur |
82℃ |
| Titik didih |
319°C at 760 mmHg |
| Indeks bias |
1.575 |
| Titik nyala |
146.8°C |
| Tekanan wap |
0.000649mmHg at 25°C |
| Cinta bahaya |
 T:Toxic;
|
| Kod Risiko |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
