ChemNet > CAS > 3491-63-2 2-Phenyl-2-pentenal
3491-63-2 2-Phenyl-2-pentenal
| Nama produk |
2-Phenyl-2-pentenal |
| Nama Inggeris |
2-Phenyl-2-pentenal;Benzeneacetaldehyde, alpha-propylidene-; (2E)-2-phenylpent-2-enal |
| MF |
C11H12O |
| Berat Molekul |
160.2124 |
| InChI |
InChI=1/C11H12O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h3-9H,2H2,1H3/b11-6- |
| CAS NO |
3491-63-2 |
| Struktur Molekul |
|
| Kepadatan |
0.976g/cm3 |
| Titik didih |
286.7°C at 760 mmHg |
| Indeks bias |
1.524 |
| Titik nyala |
106.2°C |
| Tekanan wap |
0.0026mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
