ChemNet > CAS > 36919-03-6 Methyl pentafluorophenyl carbonate
36919-03-6 Methyl pentafluorophenyl carbonate
Nama produk |
Methyl pentafluorophenyl carbonate |
Nama Inggeris |
Methyl pentafluorophenyl carbonate; Pentafluorophenyl methyl carbonate |
MF |
C8H3F5O3 |
Berat Molekul |
242.0996 |
InChI |
InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
CAS NO |
36919-03-6 |
Struktur Molekul |
|
Kepadatan |
1.567g/cm3 |
Titik didih |
207.5°C at 760 mmHg |
Indeks bias |
1.422 |
Titik nyala |
77.3°C |
Tekanan wap |
0.224mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|